C27H21BrN2O4S — CID 121043946
N-(2-benzoyl-4-bromophenyl)-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 121043946) has the molecular formula C27H21BrN2O4S and a molecular weight of 549.45 g/mol. Its IUPAC name is N-(2-benzoyl-4-bromophenyl)-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-benzoyl-4-bromophenyl)-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121043946 |
| Molecular Formula | C27H21BrN2O4S |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | N-(2-benzoyl-4-bromophenyl)-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(Br)cc3C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H21BrN2O4S/c1-18-7-14-23(15-8-18)35(33,34)30-22-12-9-20(10-13-22)27(32)29-25-16-11-21(28)17-24(25)26(31)19-5-3-2-4-6-19/h2-17,30H,1H3,(H,29,32) |
| InChIKey | XNZGYMSVJJZNCY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |