C35H26BrN3O3S — CID 3110691
N-[4-(6-bromo-4-phenylquinolin-2-yl)phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 3110691) has the molecular formula C35H26BrN3O3S and a molecular weight of 648.58 g/mol. Its IUPAC name is N-[4-(6-bromo-4-phenylquinolin-2-yl)phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[4-(6-bromo-4-phenylquinolin-2-yl)phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 3110691 |
| Molecular Formula | C35H26BrN3O3S |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 647.09 |
| IUPAC Name | N-[4-(6-bromo-4-phenylquinolin-2-yl)phenyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(-c4cc(-c5ccccc5)c5cc(Br)ccc5n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H26BrN3O3S/c1-23-7-18-30(19-8-23)43(41,42)39-29-16-11-26(12-17-29)35(40)37-28-14-9-25(10-15-28)34-22-31(24-5-3-2-4-6-24)32-21-27(36)13-20-33(32)38-34/h2-22,39H,1H3,(H,37,40) |
| InChIKey | YDFLSELZXWJZTP-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |