C27H27BrN2O4S — CID 23847974
N-(2-benzoyl-4-bromophenyl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide (PubChem CID 23847974) has the molecular formula C27H27BrN2O4S and a molecular weight of 555.49 g/mol. Its IUPAC name is N-(2-benzoyl-4-bromophenyl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide.
| Compound Name | N-(2-benzoyl-4-bromophenyl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 23847974 |
| Molecular Formula | C27H27BrN2O4S |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | N-(2-benzoyl-4-bromophenyl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Br)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27BrN2O4S/c1-30(22-10-6-3-7-11-22)35(33,34)23-15-12-20(13-16-23)27(32)29-25-17-14-21(28)18-24(25)26(31)19-8-4-2-5-9-19/h2,4-5,8-9,12-18,22H,3,6-7,10-11H2,1H3,(H,29,32) |
| InChIKey | GOAOWNZKLNYEBF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |