C24H26N2O3S2 — CID 55469203
4-[cyclohexyl(methyl)sulfamoyl]-N-(2-thiophen-2-ylphenyl)benzamide (PubChem CID 55469203) has the molecular formula C24H26N2O3S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-(2-thiophen-2-ylphenyl)benzamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(2-thiophen-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55469203 |
| Molecular Formula | C24H26N2O3S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(2-thiophen-2-ylphenyl)benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)Nc2ccccc2-c2cccs2)cc1 |
| InChI | InChI=1S/C24H26N2O3S2/c1-26(19-8-3-2-4-9-19)31(28,29)20-15-13-18(14-16-20)24(27)25-22-11-6-5-10-21(22)23-12-7-17-30-23/h5-7,10-17,19H,2-4,8-9H2,1H3,(H,25,27) |
| InChIKey | PNCOYLNJQXZQPB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |