C24H29N3O4S — CID 26706774
2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-prop-2-enylbenzamide (PubChem CID 26706774) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 26706774 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1ccc(S(=O)(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-3-17-25-24(29)21-11-7-8-12-22(21)26-23(28)18-13-15-20(16-14-18)32(30,31)27(2)19-9-5-4-6-10-19/h3,7-8,11-16,19H,1,4-6,9-10,17H2,2H3,(H,25,29)(H,26,28) |
| InChIKey | YXAZDFSQRSROAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|