C23H28ClN3O4S — CID 43071932
4-chloro-3-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 43071932) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 4-chloro-3-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43071932 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-chloro-3-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(NC(=O)c2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C23H28ClN3O4S/c1-26(2)23(29)17-11-14-20(24)21(15-17)25-22(28)16-9-12-19(13-10-16)32(30,31)27(3)18-7-5-4-6-8-18/h9-15,18H,4-8H2,1-3H3,(H,25,28) |
| InChIKey | QIBYJMYLSPESRE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |