C23H23ClN2O4S — CID 22327300
4-tert-butyl-N-[4-chloro-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]benzenesulfonamide (PubChem CID 22327300) has the molecular formula C23H23ClN2O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-chloro-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-chloro-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22327300 |
| Molecular Formula | C23H23ClN2O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 4-tert-butyl-N-[4-chloro-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]benzenesulfonamide |
| SMILES | Cc1c(C(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ccc[n+]1[O-] |
| InChI | InChI=1S/C23H23ClN2O4S/c1-15-19(6-5-13-26(15)28)22(27)20-14-17(24)9-12-21(20)25-31(29,30)18-10-7-16(8-11-18)23(2,3)4/h5-14,25H,1-4H3 |
| InChIKey | FAUONTNUWIUZHU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|