C21H20ClN2O6S2+ — CID 163623874
N-[4-chloro-2-(1-methoxy-2-methylpyridin-1-ium-3-carbonyl)phenyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 163623874) has the molecular formula C21H20ClN2O6S2+ and a molecular weight of 495.99 g/mol. Its IUPAC name is N-[4-chloro-2-(1-methoxy-2-methylpyridin-1-ium-3-carbonyl)phenyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(1-methoxy-2-methylpyridin-1-ium-3-carbonyl)phenyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 163623874 |
| Molecular Formula | C21H20ClN2O6S2+ |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | N-[4-chloro-2-(1-methoxy-2-methylpyridin-1-ium-3-carbonyl)phenyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CO[n+]1cccc(C(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C21H19ClN2O6S2/c1-14-18(5-4-12-24(14)30-2)21(25)19-13-15(22)6-11-20(19)23-32(28,29)17-9-7-16(8-10-17)31(3,26)27/h4-13H,1-3H3/p+1 |
| InChIKey | HQKZGRJPOGAXHU-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|