C14H12ClNO4S — CID 962498
2-[(4-chloro-3-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 962498) has the molecular formula C14H12ClNO4S and a molecular weight of 325.77 g/mol. Its IUPAC name is 2-[(4-chloro-3-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(4-chloro-3-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 962498 |
| Molecular Formula | C14H12ClNO4S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-[(4-chloro-3-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccccc2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H12ClNO4S/c1-9-8-10(6-7-12(9)15)21(19,20)16-13-5-3-2-4-11(13)14(17)18/h2-8,16H,1H3,(H,17,18) |
| InChIKey | NZTFKFSZZUXLOD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |