C26H14Cl4F6N2O7PS2+ — CID 88537963
bis[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]-oxophosphanium (PubChem CID 88537963) has the molecular formula C26H14Cl4F6N2O7PS2+ and a molecular weight of 817.31 g/mol. Its IUPAC name is bis[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]-oxophosphanium.
| Compound Name | bis[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]-oxophosphanium |
|---|---|
| PubChem CID | 88537963 |
| Molecular Formula | C26H14Cl4F6N2O7PS2+ |
| Molecular Weight | 817.31 g/mol |
| Exact Mass | 814.86 |
| IUPAC Name | bis[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]-oxophosphanium |
| SMILES | O=[P+](Oc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)Oc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H14Cl4F6N2O7PS2/c27-13-1-7-23(21(9-13)37-47(40,41)15-3-5-19(29)17(11-15)25(31,32)33)44-46(39)45-24-8-2-14(28)10-22(24)38-48(42,43)16-4-6-20(30)18(12-16)26(34,35)36/h1-12,37-38H/q+1 |
| InChIKey | PNPUZLFGMHYZTF-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.31 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|