C16H14Cl2F3NO3S2 — CID 67973663
4-chloro-N-(5-chloro-2-propylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 67973663) has the molecular formula C16H14Cl2F3NO3S2 and a molecular weight of 460.33 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-propylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-2-propylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67973663 |
| Molecular Formula | C16H14Cl2F3NO3S2 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-propylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCS(=O)c1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14Cl2F3NO3S2/c1-2-7-26(23)15-6-3-10(17)8-14(15)22-27(24,25)11-4-5-13(18)12(9-11)16(19,20)21/h3-6,8-9,22H,2,7H2,1H3 |
| InChIKey | OGXUUGBKAASNBG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |