C9H8ClF3S — CID 91876352
1-chloro-4-ethylsulfanyl-2-(trifluoromethyl)benzene (PubChem CID 91876352) has the molecular formula C9H8ClF3S and a molecular weight of 240.68 g/mol. Its IUPAC name is 1-chloro-4-ethylsulfanyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-4-ethylsulfanyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91876352 |
| Molecular Formula | C9H8ClF3S |
| Molecular Weight | 240.68 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1-chloro-4-ethylsulfanyl-2-(trifluoromethyl)benzene |
| SMILES | CCSc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8ClF3S/c1-2-14-6-3-4-8(10)7(5-6)9(11,12)13/h3-5H,2H2,1H3 |
| InChIKey | IPWFEZZOVVPFPL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |