C26H28N4O5S — CID 22307419
N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-2-[3-(benzenesulfonyl)-2-ethoxyanilino]acetamide (PubChem CID 22307419) has the molecular formula C26H28N4O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-2-[3-(benzenesulfonyl)-2-ethoxyanilino]acetamide.
| Compound Name | N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-2-[3-(benzenesulfonyl)-2-ethoxyanilino]acetamide |
|---|---|
| PubChem CID | 22307419 |
| Molecular Formula | C26H28N4O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-2-[3-(benzenesulfonyl)-2-ethoxyanilino]acetamide |
| SMILES | CCOc1c(NCC(=O)N/N=C(/C)c2ccc(NC(C)=O)cc2)cccc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O5S/c1-4-35-26-23(11-8-12-24(26)36(33,34)22-9-6-5-7-10-22)27-17-25(32)30-29-18(2)20-13-15-21(16-14-20)28-19(3)31/h5-16,27H,4,17H2,1-3H3,(H,28,31)(H,30,32)/b29-18- |
| InChIKey | IXBZQMPLWARYAF-MIXAMLLLSA-N |
| XLogP | 3.83 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|