C26H28N4O5S — CID 3594656
N-[1-(4-acetamidophenyl)ethylideneamino]-2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetamide (PubChem CID 3594656) has the molecular formula C26H28N4O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)ethylideneamino]-2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetamide.
| Compound Name | N-[1-(4-acetamidophenyl)ethylideneamino]-2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetamide |
|---|---|
| PubChem CID | 3594656 |
| Molecular Formula | C26H28N4O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[1-(4-acetamidophenyl)ethylideneamino]-2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NN=C(C)c1ccc(NC(C)=O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O5S/c1-4-35-25-13-9-8-12-24(25)30(36(33,34)23-10-6-5-7-11-23)18-26(32)29-28-19(2)21-14-16-22(17-15-21)27-20(3)31/h5-17H,4,18H2,1-3H3,(H,27,31)(H,29,32) |
| InChIKey | FKBWPLKIOKIVFJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|