C25H26ClN3O5S — CID 126117459
2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]acetamide (PubChem CID 126117459) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 126117459 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C(/C)c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClN3O5S/c1-4-34-24-8-6-5-7-23(24)29(35(31,32)22-15-11-20(26)12-16-22)17-25(30)28-27-18(2)19-9-13-21(33-3)14-10-19/h5-16H,4,17H2,1-3H3,(H,28,30)/b27-18- |
| InChIKey | BDHDSSUYBSPTNK-IMRQLAEWSA-N |
| XLogP | 4.48 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|