C10H17N3O — CID 115260467
N-(hydrazinylmethyl)-2-methoxy-3,5-dimethylaniline (PubChem CID 115260467) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-2-methoxy-3,5-dimethylaniline.
| Compound Name | N-(hydrazinylmethyl)-2-methoxy-3,5-dimethylaniline |
|---|---|
| PubChem CID | 115260467 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(hydrazinylmethyl)-2-methoxy-3,5-dimethylaniline |
| SMILES | COc1c(C)cc(C)cc1NCNN |
| InChI | InChI=1S/C10H17N3O/c1-7-4-8(2)10(14-3)9(5-7)12-6-13-11/h4-5,12-13H,6,11H2,1-3H3 |
| InChIKey | NMJRUJDGVPPKRO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|