C13H21NO — CID 82267547
N-ethyl-3,5-dimethyl-2-propan-2-yloxyaniline (PubChem CID 82267547) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-2-propan-2-yloxyaniline.
| Compound Name | N-ethyl-3,5-dimethyl-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 82267547 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-ethyl-3,5-dimethyl-2-propan-2-yloxyaniline |
| SMILES | CCNc1cc(C)cc(C)c1OC(C)C |
| InChI | InChI=1S/C13H21NO/c1-6-14-12-8-10(4)7-11(5)13(12)15-9(2)3/h7-9,14H,6H2,1-5H3 |
| InChIKey | DMKVSJYRQVAFJK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |