C20H28N2O — CID 54805651
N-(2-propan-2-yloxyphenyl)-N'-(2,4,6-trimethylphenyl)ethane-1,2-diamine (PubChem CID 54805651) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(2-propan-2-yloxyphenyl)-N'-(2,4,6-trimethylphenyl)ethane-1,2-diamine.
| Compound Name | N-(2-propan-2-yloxyphenyl)-N'-(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54805651 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-(2-propan-2-yloxyphenyl)-N'-(2,4,6-trimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(C)c(NCCNc2ccccc2OC(C)C)c(C)c1 |
| InChI | InChI=1S/C20H28N2O/c1-14(2)23-19-9-7-6-8-18(19)21-10-11-22-20-16(4)12-15(3)13-17(20)5/h6-9,12-14,21-22H,10-11H2,1-5H3 |
| InChIKey | DKNWKPJRIUUXJB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|