C17H20Cl2N2O — CID 54809748
N'-(2,5-dichlorophenyl)-N-(2-propan-2-yloxyphenyl)ethane-1,2-diamine (PubChem CID 54809748) has the molecular formula C17H20Cl2N2O and a molecular weight of 339.27 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)-N-(2-propan-2-yloxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(2,5-dichlorophenyl)-N-(2-propan-2-yloxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809748 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N'-(2,5-dichlorophenyl)-N-(2-propan-2-yloxyphenyl)ethane-1,2-diamine |
| SMILES | CC(C)Oc1ccccc1NCCNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O/c1-12(2)22-17-6-4-3-5-15(17)20-9-10-21-16-11-13(18)7-8-14(16)19/h3-8,11-12,20-21H,9-10H2,1-2H3 |
| InChIKey | DCODEIHRQUPBSH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|