C14H12Cl4N2 — CID 54809670
N-(2,3-dichlorophenyl)-N'-(2,5-dichlorophenyl)ethane-1,2-diamine (PubChem CID 54809670) has the molecular formula C14H12Cl4N2 and a molecular weight of 350.08 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-(2,5-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | N-(2,3-dichlorophenyl)-N'-(2,5-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809670 |
| Molecular Formula | C14H12Cl4N2 |
| Molecular Weight | 350.08 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-(2,5-dichlorophenyl)ethane-1,2-diamine |
| SMILES | Clc1ccc(Cl)c(NCCNc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H12Cl4N2/c15-9-4-5-10(16)13(8-9)20-7-6-19-12-3-1-2-11(17)14(12)18/h1-5,8,19-20H,6-7H2 |
| InChIKey | OMQHDHJNFKAZGW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.08 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|