C17H20Cl2N2 — CID 54809490
N-(2,3-dichlorophenyl)-N'-(1-phenylpropyl)ethane-1,2-diamine (PubChem CID 54809490) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-(1-phenylpropyl)ethane-1,2-diamine.
| Compound Name | N-(2,3-dichlorophenyl)-N'-(1-phenylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809490 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-(1-phenylpropyl)ethane-1,2-diamine |
| SMILES | CCC(NCCNc1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H20Cl2N2/c1-2-15(13-7-4-3-5-8-13)20-11-12-21-16-10-6-9-14(18)17(16)19/h3-10,15,20-21H,2,11-12H2,1H3 |
| InChIKey | RSAXALRVJORQAZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|