C9H10Cl2FN — CID 81106558
2,3-dichloro-N-(3-fluoropropyl)aniline (PubChem CID 81106558) has the molecular formula C9H10Cl2FN and a molecular weight of 222.09 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-fluoropropyl)aniline.
| Compound Name | 2,3-dichloro-N-(3-fluoropropyl)aniline |
|---|---|
| PubChem CID | 81106558 |
| Molecular Formula | C9H10Cl2FN |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2,3-dichloro-N-(3-fluoropropyl)aniline |
| SMILES | FCCCNc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2FN/c10-7-3-1-4-8(9(7)11)13-6-2-5-12/h1,3-4,13H,2,5-6H2 |
| InChIKey | MHZDLNPUXKPGJP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|