C8H7Cl2F2N — CID 60921632
2,3-dichloro-N-(2,2-difluoroethyl)aniline (PubChem CID 60921632) has the molecular formula C8H7Cl2F2N and a molecular weight of 226.05 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,2-difluoroethyl)aniline.
| Compound Name | 2,3-dichloro-N-(2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 60921632 |
| Molecular Formula | C8H7Cl2F2N |
| Molecular Weight | 226.05 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2,3-dichloro-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl2F2N/c9-5-2-1-3-6(8(5)10)13-4-7(11)12/h1-3,7,13H,4H2 |
| InChIKey | QLIVUDYGBPRGIO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.05 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |