C13H20Cl2N2O — CID 60899997
1-(2,3-dichloroanilino)-3-(diethylamino)propan-2-ol (PubChem CID 60899997) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is 1-(2,3-dichloroanilino)-3-(diethylamino)propan-2-ol.
| Compound Name | 1-(2,3-dichloroanilino)-3-(diethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60899997 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-(2,3-dichloroanilino)-3-(diethylamino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H20Cl2N2O/c1-3-17(4-2)9-10(18)8-16-12-7-5-6-11(14)13(12)15/h5-7,10,16,18H,3-4,8-9H2,1-2H3 |
| InChIKey | LWMCIZOOGAVJRI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |