C15H26N2O3 — CID 60897898
1-(diethylamino)-3-(2,5-dimethoxyanilino)propan-2-ol (PubChem CID 60897898) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(diethylamino)-3-(2,5-dimethoxyanilino)propan-2-ol.
| Compound Name | 1-(diethylamino)-3-(2,5-dimethoxyanilino)propan-2-ol |
|---|---|
| PubChem CID | 60897898 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(diethylamino)-3-(2,5-dimethoxyanilino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNc1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H26N2O3/c1-5-17(6-2)11-12(18)10-16-14-9-13(19-3)7-8-15(14)20-4/h7-9,12,16,18H,5-6,10-11H2,1-4H3 |
| InChIKey | DEKAVUVDTLTCMW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |