C12H20N2O2 — CID 28575908
N-(2,5-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 28575908) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(2,5-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28575908 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(NCCN(C)C)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-14(2)8-7-13-11-9-10(15-3)5-6-12(11)16-4/h5-6,9,13H,7-8H2,1-4H3 |
| InChIKey | FWAIBRHWMBTDCY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |