C16H20N2O2 — CID 54806144
N'-(2,5-dimethoxyphenyl)-N-phenylethane-1,2-diamine (PubChem CID 54806144) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-phenylethane-1,2-diamine.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 54806144 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-phenylethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(NCCNc2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-19-14-8-9-16(20-2)15(12-14)18-11-10-17-13-6-4-3-5-7-13/h3-9,12,17-18H,10-11H2,1-2H3 |
| InChIKey | YOHLCWGFFRVEAC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|