C16H19ClN2O2 — CID 54806452
N-(3-chlorophenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 54806452) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-(3-chlorophenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54806452 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-(3-chlorophenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(NCCNc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-20-14-6-7-16(21-2)15(11-14)19-9-8-18-13-5-3-4-12(17)10-13/h3-7,10-11,18-19H,8-9H2,1-2H3 |
| InChIKey | LSOXOEXHFQGOFU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|