C17H21ClN2O2 — CID 54807475
N-(3-chloro-2-methylphenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 54807475) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54807475 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(NCCNc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-12-14(18)5-4-6-15(12)19-9-10-20-16-11-13(21-2)7-8-17(16)22-3/h4-8,11,19-20H,9-10H2,1-3H3 |
| InChIKey | BVPBUXPDIIKMKM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|