C18H24N2O3 — CID 54807830
N'-(2,5-dimethoxyphenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine (PubChem CID 54807830) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54807830 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine |
| SMILES | CCOc1cccc(NCCNc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C18H24N2O3/c1-4-23-16-7-5-6-14(12-16)19-10-11-20-17-13-15(21-2)8-9-18(17)22-3/h5-9,12-13,19-20H,4,10-11H2,1-3H3 |
| InChIKey | FMGUDLFNCJCJHC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|