About 3-ethoxy-N-propylaniline
3-ethoxy-N-propylaniline (PubChem CID 54800867) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-ethoxy-N-propylaniline.
Molecular Properties
| Compound Name | 3-ethoxy-N-propylaniline |
| PubChem CID | 54800867 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-ethoxy-N-propylaniline |
| SMILES | CCCNc1cccc(OCC)c1 |
| InChI | InChI=1S/C11H17NO/c1-3-8-12-10-6-5-7-11(9-10)13-4-2/h5-7,9,12H,3-4,8H2,1-2H3 |
| InChIKey | ADHDYNOPHKFBLL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-propylaniline?
The IUPAC name of 3-ethoxy-N-propylaniline (CID 54800867) is 3-ethoxy-N-propylaniline.
What is the SMILES notation for 3-ethoxy-N-propylaniline?
The canonical SMILES for 3-ethoxy-N-propylaniline is CCCNc1cccc(OCC)c1.
What is the InChIKey of 3-ethoxy-N-propylaniline?
The InChIKey is ADHDYNOPHKFBLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-8-12-10-6-5-7-11(9-10)13-4-2/h5-7,9,12H,3-4,8H2,1-2H3.
What are the key properties of 3-ethoxy-N-propylaniline?
3-ethoxy-N-propylaniline has a molecular weight of 179.26 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-propylaniline is sourced from PubChem (CID 54800867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).