C12H20N2O — CID 54808097
N'-(3-ethoxyphenyl)-N-ethylethane-1,2-diamine (PubChem CID 54808097) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-(3-ethoxyphenyl)-N-ethylethane-1,2-diamine.
| Compound Name | N'-(3-ethoxyphenyl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 54808097 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-(3-ethoxyphenyl)-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNc1cccc(OCC)c1 |
| InChI | InChI=1S/C12H20N2O/c1-3-13-8-9-14-11-6-5-7-12(10-11)15-4-2/h5-7,10,13-14H,3-4,8-9H2,1-2H3 |
| InChIKey | DSWKGTPUHJRZKF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|