C11H18N2O — CID 54808363
N'-(3-ethoxyphenyl)-N-methylethane-1,2-diamine (PubChem CID 54808363) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-(3-ethoxyphenyl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(3-ethoxyphenyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 54808363 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N'-(3-ethoxyphenyl)-N-methylethane-1,2-diamine |
| SMILES | CCOc1cccc(NCCNC)c1 |
| InChI | InChI=1S/C11H18N2O/c1-3-14-11-6-4-5-10(9-11)13-8-7-12-2/h4-6,9,12-13H,3,7-8H2,1-2H3 |
| InChIKey | XTNILLKAIUFFKV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|