C16H18Cl2N2O — CID 54805983
N'-(3,4-dichlorophenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine (PubChem CID 54805983) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(3,4-dichlorophenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54805983 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N'-(3,4-dichlorophenyl)-N-(3-ethoxyphenyl)ethane-1,2-diamine |
| SMILES | CCOc1cccc(NCCNc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-21-14-5-3-4-12(10-14)19-8-9-20-13-6-7-15(17)16(18)11-13/h3-7,10-11,19-20H,2,8-9H2,1H3 |
| InChIKey | LJDPDMHNPRKFSL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|