C13H19NO2 — CID 114471918
2,5-dimethoxy-N-(3-methylbut-3-enyl)aniline (PubChem CID 114471918) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(3-methylbut-3-enyl)aniline.
| Compound Name | 2,5-dimethoxy-N-(3-methylbut-3-enyl)aniline |
|---|---|
| PubChem CID | 114471918 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2,5-dimethoxy-N-(3-methylbut-3-enyl)aniline |
| SMILES | C=C(C)CCNc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H19NO2/c1-10(2)7-8-14-12-9-11(15-3)5-6-13(12)16-4/h5-6,9,14H,1,7-8H2,2-4H3 |
| InChIKey | HHXJVOHZGRHLFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|