C20H26N2O5 — CID 109028189
3-(2,5-dimethoxyanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 109028189) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2,5-dimethoxyanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 109028189 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-(2,5-dimethoxyanilino)-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(OC)c(NCCC(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H26N2O5/c1-24-15-6-8-17(25-2)16(12-15)21-10-9-20(23)22-13-14-5-7-18(26-3)19(11-14)27-4/h5-8,11-12,21H,9-10,13H2,1-4H3,(H,22,23) |
| InChIKey | GZXBPFLEAIIZOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |