C19H24N2O3 — CID 47877777
3-(2-methoxy-5-methylanilino)-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 47877777) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-(2-methoxy-5-methylanilino)-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2-methoxy-5-methylanilino)-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 47877777 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-(2-methoxy-5-methylanilino)-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CCNc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-14-4-9-18(24-3)17(12-14)20-11-10-19(22)21-13-15-5-7-16(23-2)8-6-15/h4-9,12,20H,10-11,13H2,1-3H3,(H,21,22) |
| InChIKey | WLPWHAPGUMSFGN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |