C15H23N3O4 — CID 108943905
N'-(2,5-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]propanediamide (PubChem CID 108943905) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]propanediamide.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
|---|---|
| PubChem CID | 108943905 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
| SMILES | COc1ccc(OC)c(NC(=O)CC(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C15H23N3O4/c1-18(2)8-7-16-14(19)10-15(20)17-12-9-11(21-3)5-6-13(12)22-4/h5-6,9H,7-8,10H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | LGANNALVWRZHTL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|