C17H25N3O4 — CID 108973517
1-N'-(2,5-dimethoxyphenyl)-1-N-[2-(dimethylamino)ethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108973517) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-N'-(2,5-dimethoxyphenyl)-1-N-[2-(dimethylamino)ethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2,5-dimethoxyphenyl)-1-N-[2-(dimethylamino)ethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973517 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-N'-(2,5-dimethoxyphenyl)-1-N-[2-(dimethylamino)ethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2(C(=O)NCCN(C)C)CC2)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-20(2)10-9-18-15(21)17(7-8-17)16(22)19-13-11-12(23-3)5-6-14(13)24-4/h5-6,11H,7-10H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | MHXFULRHQMFFQG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|