C11H14ClF2NO3 — CID 168639388
1-chloro-3-[2-(difluoromethoxy)-5-methoxyanilino]propan-2-ol (PubChem CID 168639388) has the molecular formula C11H14ClF2NO3 and a molecular weight of 281.69 g/mol. Its IUPAC name is 1-chloro-3-[2-(difluoromethoxy)-5-methoxyanilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-(difluoromethoxy)-5-methoxyanilino]propan-2-ol |
|---|---|
| PubChem CID | 168639388 |
| Molecular Formula | C11H14ClF2NO3 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-chloro-3-[2-(difluoromethoxy)-5-methoxyanilino]propan-2-ol |
| SMILES | COc1ccc(OC(F)F)c(NCC(O)CCl)c1 |
| InChI | InChI=1S/C11H14ClF2NO3/c1-17-8-2-3-10(18-11(13)14)9(4-8)15-6-7(16)5-12/h2-4,7,11,15-16H,5-6H2,1H3 |
| InChIKey | KGRQDNNNGSTFGL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|