C17H15ClF5NO3 — CID 168640446
1-chloro-3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-methoxyanilino]propan-2-ol (PubChem CID 168640446) has the molecular formula C17H15ClF5NO3 and a molecular weight of 411.75 g/mol. Its IUPAC name is 1-chloro-3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-methoxyanilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-methoxyanilino]propan-2-ol |
|---|---|
| PubChem CID | 168640446 |
| Molecular Formula | C17H15ClF5NO3 |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-chloro-3-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-methoxyanilino]propan-2-ol |
| SMILES | COc1ccc(Oc2c(F)cc(C(F)(F)F)cc2F)c(NCC(O)CCl)c1 |
| InChI | InChI=1S/C17H15ClF5NO3/c1-26-11-2-3-15(14(6-11)24-8-10(25)7-18)27-16-12(19)4-9(5-13(16)20)17(21,22)23/h2-6,10,24-25H,7-8H2,1H3 |
| InChIKey | IHHDKCPCORGHLS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|