C16H12BrClF5NO2 — CID 168640562
1-[3-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-3-chloropropan-2-ol (PubChem CID 168640562) has the molecular formula C16H12BrClF5NO2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[3-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-3-chloropropan-2-ol.
| Compound Name | 1-[3-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 168640562 |
| Molecular Formula | C16H12BrClF5NO2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | 1-[3-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-3-chloropropan-2-ol |
| SMILES | OC(CCl)CNc1cc(Br)cc(Oc2c(F)cc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C16H12BrClF5NO2/c17-9-3-10(24-7-11(25)6-18)5-12(4-9)26-15-13(19)1-8(2-14(15)20)16(21,22)23/h1-5,11,24-25H,6-7H2 |
| InChIKey | QPXQQTDZMMVKFT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|