C9H10Br2ClNO2 — CID 168636765
2,6-dibromo-4-[(3-chloro-2-hydroxypropyl)amino]phenol (PubChem CID 168636765) has the molecular formula C9H10Br2ClNO2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3-chloro-2-hydroxypropyl)amino]phenol.
| Compound Name | 2,6-dibromo-4-[(3-chloro-2-hydroxypropyl)amino]phenol |
|---|---|
| PubChem CID | 168636765 |
| Molecular Formula | C9H10Br2ClNO2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 356.88 |
| IUPAC Name | 2,6-dibromo-4-[(3-chloro-2-hydroxypropyl)amino]phenol |
| SMILES | Oc1c(Br)cc(NCC(O)CCl)cc1Br |
| InChI | InChI=1S/C9H10Br2ClNO2/c10-7-1-5(2-8(11)9(7)15)13-4-6(14)3-12/h1-2,6,13-15H,3-4H2 |
| InChIKey | RDRNYDYEUSEKQA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|