C11H14ClF2NO2 — CID 168640847
1-chloro-3-(4-ethoxy-3,5-difluoroanilino)propan-2-ol (PubChem CID 168640847) has the molecular formula C11H14ClF2NO2 and a molecular weight of 265.69 g/mol. Its IUPAC name is 1-chloro-3-(4-ethoxy-3,5-difluoroanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(4-ethoxy-3,5-difluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 168640847 |
| Molecular Formula | C11H14ClF2NO2 |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-chloro-3-(4-ethoxy-3,5-difluoroanilino)propan-2-ol |
| SMILES | CCOc1c(F)cc(NCC(O)CCl)cc1F |
| InChI | InChI=1S/C11H14ClF2NO2/c1-2-17-11-9(13)3-7(4-10(11)14)15-6-8(16)5-12/h3-4,8,15-16H,2,5-6H2,1H3 |
| InChIKey | ABPUAJFKANJABT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|