C14H19F2NO3 — CID 168597020
3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propane-1,2-diol (PubChem CID 168597020) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propane-1,2-diol.
| Compound Name | 3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597020 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(F)c(OCC2CCC2)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO3/c15-12-4-10(17-6-11(19)7-18)5-13(16)14(12)20-8-9-2-1-3-9/h4-5,9,11,17-19H,1-3,6-8H2 |
| InChIKey | KOIPOAUDKFJPON-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|