C12H16FNO4 — CID 168597125
3-[3-fluoro-4-(oxetan-3-yloxy)anilino]propane-1,2-diol (PubChem CID 168597125) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is 3-[3-fluoro-4-(oxetan-3-yloxy)anilino]propane-1,2-diol.
| Compound Name | 3-[3-fluoro-4-(oxetan-3-yloxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597125 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[3-fluoro-4-(oxetan-3-yloxy)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(OC2COC2)c(F)c1 |
| InChI | InChI=1S/C12H16FNO4/c13-11-3-8(14-4-9(16)5-15)1-2-12(11)18-10-6-17-7-10/h1-3,9-10,14-16H,4-7H2 |
| InChIKey | IUDKZHJACOMIAA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|