C11H12F5NO3 — CID 168594474
3-[4-(difluoromethoxy)-3-(trifluoromethyl)anilino]propane-1,2-diol (PubChem CID 168594474) has the molecular formula C11H12F5NO3 and a molecular weight of 301.21 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-(trifluoromethyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-(difluoromethoxy)-3-(trifluoromethyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594474 |
| Molecular Formula | C11H12F5NO3 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-(trifluoromethyl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(OC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F5NO3/c12-10(13)20-9-2-1-6(17-4-7(19)5-18)3-8(9)11(14,15)16/h1-3,7,10,17-19H,4-5H2 |
| InChIKey | FJBWLRJMDYGDDE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|