C9H7F5N2OS — CID 169359443
[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]thiourea (PubChem CID 169359443) has the molecular formula C9H7F5N2OS and a molecular weight of 286.23 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | [4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 169359443 |
| Molecular Formula | C9H7F5N2OS |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | [4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(OC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F5N2OS/c10-7(11)17-6-2-1-4(16-8(15)18)3-5(6)9(12,13)14/h1-3,7H,(H3,15,16,18) |
| InChIKey | JUFLFPGFSCIUCQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|