C16H25N3O3S — CID 22981082
tert-butyl N-[2-[5-(carbamothioylamino)-2-methoxyphenyl]propan-2-yl]carbamate (PubChem CID 22981082) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(carbamothioylamino)-2-methoxyphenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(carbamothioylamino)-2-methoxyphenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 22981082 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl N-[2-[5-(carbamothioylamino)-2-methoxyphenyl]propan-2-yl]carbamate |
| SMILES | COc1ccc(NC(N)=S)cc1C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O3S/c1-15(2,3)22-14(20)19-16(4,5)11-9-10(18-13(17)23)7-8-12(11)21-6/h7-9H,1-6H3,(H,19,20)(H3,17,18,23) |
| InChIKey | WQIISHLEMYNCKS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|