C8H11N3O3S2 — CID 169359137
(3-methoxy-4-sulfamoylphenyl)thiourea (PubChem CID 169359137) has the molecular formula C8H11N3O3S2 and a molecular weight of 261.33 g/mol. Its IUPAC name is (3-methoxy-4-sulfamoylphenyl)thiourea.
| Compound Name | (3-methoxy-4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 169359137 |
| Molecular Formula | C8H11N3O3S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (3-methoxy-4-sulfamoylphenyl)thiourea |
| SMILES | COc1cc(NC(N)=S)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H11N3O3S2/c1-14-6-4-5(11-8(9)15)2-3-7(6)16(10,12)13/h2-4H,1H3,(H3,9,11,15)(H2,10,12,13) |
| InChIKey | OXQRZFBAQCPHQO-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|